C35H48N4O8 — CID 140576974
tert-butyl (2S,5R)-5-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-2-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 140576974) has the molecular formula C35H48N4O8 and a molecular weight of 652.79 g/mol. Its IUPAC name is tert-butyl (2S,5R)-5-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-2-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-5-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-2-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140576974 |
| Molecular Formula | C35H48N4O8 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.35 |
| IUPAC Name | tert-butyl (2S,5R)-5-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxyamino]-2-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)OC(C)(C)C)CC[C@H]1C(=O)NC1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C35H48N4O8/c1-34(2,3)46-32(42)38-22-28(39(33(43)47-35(4,5)6)45-24-26-15-11-8-12-16-26)17-18-29(38)30(40)36-27-19-20-37(21-27)31(41)44-23-25-13-9-7-10-14-25/h7-16,27-29H,17-24H2,1-6H3,(H,36,40)/t27?,28-,29+/m1/s1 |
| InChIKey | VBRVUYPCAZCTSQ-WUFLDLQOSA-N |
| XLogP | 5.65 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|