C33H54N4O8 — CID 89008836
tert-butyl 5-[butoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[[(2R)-4-[methyl(phenylmethoxycarbonyl)amino]butan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 89008836) has the molecular formula C33H54N4O8 and a molecular weight of 634.82 g/mol. Its IUPAC name is tert-butyl 5-[butoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[[(2R)-4-[methyl(phenylmethoxycarbonyl)amino]butan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 5-[butoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[[(2R)-4-[methyl(phenylmethoxycarbonyl)amino]butan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89008836 |
| Molecular Formula | C33H54N4O8 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | tert-butyl 5-[butoxy-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-[[(2R)-4-[methyl(phenylmethoxycarbonyl)amino]butan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CCCCON(C(=O)OC(C)(C)C)C1CCC(C(=O)N[C@H](C)CCN(C)C(=O)OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C33H54N4O8/c1-10-11-21-43-37(31(41)45-33(6,7)8)26-17-18-27(36(22-26)30(40)44-32(3,4)5)28(38)34-24(2)19-20-35(9)29(39)42-23-25-15-13-12-14-16-25/h12-16,24,26-27H,10-11,17-23H2,1-9H3,(H,34,38)/t24-,26?,27?/m1/s1 |
| InChIKey | ACVWVSXIQIYLTM-YXKBGSERSA-N |
| XLogP | 5.89 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|