C22H34N2O6 — CID 146823316
2-O-benzyl 1-O-tert-butyl 5-[[hydroxy(propan-2-yloxy)methyl]amino]piperidine-1,2-dicarboxylate (PubChem CID 146823316) has the molecular formula C22H34N2O6 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 5-[[hydroxy(propan-2-yloxy)methyl]amino]piperidine-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 5-[[hydroxy(propan-2-yloxy)methyl]amino]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 146823316 |
| Molecular Formula | C22H34N2O6 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 5-[[hydroxy(propan-2-yloxy)methyl]amino]piperidine-1,2-dicarboxylate |
| SMILES | CC(C)OC(O)NC1CCC(C(=O)OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H34N2O6/c1-15(2)29-20(26)23-17-11-12-18(24(13-17)21(27)30-22(3,4)5)19(25)28-14-16-9-7-6-8-10-16/h6-10,15,17-18,20,23,26H,11-14H2,1-5H3 |
| InChIKey | SCLUDJOQTFKTGM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|