C25H28ClN3O7S — CID 140738357
tert-butyl (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-2-(4-nitrophenyl)sulfanylcarbonylpiperidine-1-carboxylate (PubChem CID 140738357) has the molecular formula C25H28ClN3O7S and a molecular weight of 550.03 g/mol. Its IUPAC name is tert-butyl (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-2-(4-nitrophenyl)sulfanylcarbonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-2-(4-nitrophenyl)sulfanylcarbonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 140738357 |
| Molecular Formula | C25H28ClN3O7S |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | tert-butyl (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-2-(4-nitrophenyl)sulfanylcarbonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)Cl)CC[C@H]1C(=O)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28ClN3O7S/c1-25(2,3)36-24(32)27-15-19(28(23(26)31)35-16-17-7-5-4-6-8-17)11-14-21(27)22(30)37-20-12-9-18(10-13-20)29(33)34/h4-10,12-13,19,21H,11,14-16H2,1-3H3/t19-,21+/m1/s1 |
| InChIKey | PUQIMSAUDDKEIX-CTNGQTDRSA-N |
| XLogP | 5.77 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|