C36H47N5O12 — CID 154695975
ditert-butyl (2S)-2-[[[(3S,5R)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidin-3-yl]-(4-nitrophenoxy)carbonylamino]methyl]piperazine-1,4-dicarboxylate (PubChem CID 154695975) has the molecular formula C36H47N5O12 and a molecular weight of 741.80 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[[(3S,5R)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidin-3-yl]-(4-nitrophenoxy)carbonylamino]methyl]piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl (2S)-2-[[[(3S,5R)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidin-3-yl]-(4-nitrophenoxy)carbonylamino]methyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 154695975 |
| Molecular Formula | C36H47N5O12 |
| Molecular Weight | 741.80 g/mol |
| Exact Mass | 741.32 |
| IUPAC Name | ditert-butyl (2S)-2-[[[(3S,5R)-5-methoxycarbonyl-1-phenylmethoxycarbonylpyrrolidin-3-yl]-(4-nitrophenoxy)carbonylamino]methyl]piperazine-1,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@H](N(C[C@@H]2CN(C(=O)OC(C)(C)C)CCN2C(=O)OC(C)(C)C)C(=O)Oc2ccc([N+](=O)[O-])cc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H47N5O12/c1-35(2,3)52-31(43)37-17-18-38(34(46)53-36(4,5)6)27(20-37)22-39(33(45)51-28-15-13-25(14-16-28)41(47)48)26-19-29(30(42)49-7)40(21-26)32(44)50-23-24-11-9-8-10-12-24/h8-16,26-27,29H,17-23H2,1-7H3/t26-,27-,29+/m0/s1 |
| InChIKey | MDDQZGVPEGIMCB-HPUNYJORSA-N |
| XLogP | 5.20 |
| TPSA | 187.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|