C38H46N4O10 — CID 154695969
ditert-butyl 2-[[(4-nitrophenoxy)carbonyl-[(2R)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]methyl]piperazine-1,4-dicarboxylate (PubChem CID 154695969) has the molecular formula C38H46N4O10 and a molecular weight of 718.80 g/mol. Its IUPAC name is ditert-butyl 2-[[(4-nitrophenoxy)carbonyl-[(2R)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]methyl]piperazine-1,4-dicarboxylate.
| Compound Name | ditert-butyl 2-[[(4-nitrophenoxy)carbonyl-[(2R)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]methyl]piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 154695969 |
| Molecular Formula | C38H46N4O10 |
| Molecular Weight | 718.80 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | ditert-butyl 2-[[(4-nitrophenoxy)carbonyl-[(2R)-1-oxo-3-phenyl-1-phenylmethoxypropan-2-yl]amino]methyl]piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)[C@H](Cc2ccccc2)C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C38H46N4O10/c1-37(2,3)51-34(44)39-21-22-40(36(46)52-38(4,5)6)30(24-39)25-41(35(45)50-31-19-17-29(18-20-31)42(47)48)32(23-27-13-9-7-10-14-27)33(43)49-26-28-15-11-8-12-16-28/h7-20,30,32H,21-26H2,1-6H3/t30?,32-/m1/s1 |
| InChIKey | ZQFCYIRMUHHHOY-BDJZEIKTSA-N |
| XLogP | 6.61 |
| TPSA | 158.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.80 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|