C25H24ClF5N2O6 — CID 122516077
(2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxylic acid (PubChem CID 122516077) has the molecular formula C25H24ClF5N2O6 and a molecular weight of 578.92 g/mol. Its IUPAC name is (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122516077 |
| Molecular Formula | C25H24ClF5N2O6 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 578.12 |
| IUPAC Name | (2S,5R)-5-[carbonochloridoyl(phenylmethoxy)amino]-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-(2,3,4,5,6-pentafluorophenyl)piperidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)C(=O)Cl)CC[C@@]1(C(=O)O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H24ClF5N2O6/c1-24(2,3)39-23(37)32-11-14(33(22(26)36)38-12-13-7-5-4-6-8-13)9-10-25(32,21(34)35)15-16(27)18(29)20(31)19(30)17(15)28/h4-8,14H,9-12H2,1-3H3,(H,34,35)/t14-,25+/m1/s1 |
| InChIKey | GJGUAUHMPKYRSS-PWECECGKSA-N |
| XLogP | 5.85 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|