C23H24Cl3N3O6 — CID 122436916
(2S,5R)-2-(benzylcarbamoyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1-carboxylic acid (PubChem CID 122436916) has the molecular formula C23H24Cl3N3O6 and a molecular weight of 544.82 g/mol. Its IUPAC name is (2S,5R)-2-(benzylcarbamoyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1-carboxylic acid.
| Compound Name | (2S,5R)-2-(benzylcarbamoyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122436916 |
| Molecular Formula | C23H24Cl3N3O6 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | (2S,5R)-2-(benzylcarbamoyl)-5-[phenylmethoxy(trichloromethoxycarbonyl)amino]piperidine-1-carboxylic acid |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CC[C@@H](N(OCc2ccccc2)C(=O)OC(Cl)(Cl)Cl)CN1C(=O)O |
| InChI | InChI=1S/C23H24Cl3N3O6/c24-23(25,26)35-22(33)29(34-15-17-9-5-2-6-10-17)18-11-12-19(28(14-18)21(31)32)20(30)27-13-16-7-3-1-4-8-16/h1-10,18-19H,11-15H2,(H,27,30)(H,31,32)/t18-,19+/m1/s1 |
| InChIKey | YVPKSHNCYCJMCP-MOPGFXCFSA-N |
| XLogP | 4.71 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|