C29H29ClN4O7 — CID 155234371
(2S,5R)-2-[[(4-chlorobenzoyl)amino]carbamoyl]-5-[phenylmethoxy(phenylmethoxycarbonyl)amino]piperidine-1-carboxylic acid (PubChem CID 155234371) has the molecular formula C29H29ClN4O7 and a molecular weight of 581.03 g/mol. Its IUPAC name is (2S,5R)-2-[[(4-chlorobenzoyl)amino]carbamoyl]-5-[phenylmethoxy(phenylmethoxycarbonyl)amino]piperidine-1-carboxylic acid.
| Compound Name | (2S,5R)-2-[[(4-chlorobenzoyl)amino]carbamoyl]-5-[phenylmethoxy(phenylmethoxycarbonyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155234371 |
| Molecular Formula | C29H29ClN4O7 |
| Molecular Weight | 581.03 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (2S,5R)-2-[[(4-chlorobenzoyl)amino]carbamoyl]-5-[phenylmethoxy(phenylmethoxycarbonyl)amino]piperidine-1-carboxylic acid |
| SMILES | O=C(NNC(=O)[C@@H]1CC[C@@H](N(OCc2ccccc2)C(=O)OCc2ccccc2)CN1C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H29ClN4O7/c30-23-13-11-22(12-14-23)26(35)31-32-27(36)25-16-15-24(17-33(25)28(37)38)34(41-19-21-9-5-2-6-10-21)29(39)40-18-20-7-3-1-4-8-20/h1-14,24-25H,15-19H2,(H,31,35)(H,32,36)(H,37,38)/t24-,25+/m1/s1 |
| InChIKey | AXCWOYICEVUBMV-RPBOFIJWSA-N |
| XLogP | 4.38 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|