C27H31F3N4O6 — CID 155245658
tert-butyl (2R,5S)-5-(phenylmethoxycarbonylamino)-2-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 155245658) has the molecular formula C27H31F3N4O6 and a molecular weight of 564.56 g/mol. Its IUPAC name is tert-butyl (2R,5S)-5-(phenylmethoxycarbonylamino)-2-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5S)-5-(phenylmethoxycarbonylamino)-2-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155245658 |
| Molecular Formula | C27H31F3N4O6 |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | tert-butyl (2R,5S)-5-(phenylmethoxycarbonylamino)-2-[[[4-(trifluoromethyl)benzoyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](NC(=O)OCc2ccccc2)CC[C@@H]1C(=O)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H31F3N4O6/c1-26(2,3)40-25(38)34-15-20(31-24(37)39-16-17-7-5-4-6-8-17)13-14-21(34)23(36)33-32-22(35)18-9-11-19(12-10-18)27(28,29)30/h4-12,20-21H,13-16H2,1-3H3,(H,31,37)(H,32,35)(H,33,36)/t20-,21+/m0/s1 |
| InChIKey | GOLRWAZCFYJYSR-LEWJYISDSA-N |
| XLogP | 4.16 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|