C15H20N4O5 — CID 155234319
(2R,5S)-2-(hydrazinecarbonyl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylic acid (PubChem CID 155234319) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2R,5S)-2-(hydrazinecarbonyl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylic acid.
| Compound Name | (2R,5S)-2-(hydrazinecarbonyl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155234319 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (2R,5S)-2-(hydrazinecarbonyl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylic acid |
| SMILES | NNC(=O)[C@H]1CC[C@H](NC(=O)OCc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C15H20N4O5/c16-18-13(20)12-7-6-11(8-19(12)15(22)23)17-14(21)24-9-10-4-2-1-3-5-10/h1-5,11-12H,6-9,16H2,(H,17,21)(H,18,20)(H,22,23)/t11-,12+/m0/s1 |
| InChIKey | LEABQHLBJQXPKQ-NWDGAFQWSA-N |
| XLogP | 0.41 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|