C30H36N4O6S — CID 59084326
tert-butyl (3S)-3-[(2-nitrophenyl)sulfonyl-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]amino]pyrrolidine-1-carboxylate (PubChem CID 59084326) has the molecular formula C30H36N4O6S and a molecular weight of 580.71 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2-nitrophenyl)sulfonyl-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2-nitrophenyl)sulfonyl-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59084326 |
| Molecular Formula | C30H36N4O6S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | tert-butyl (3S)-3-[(2-nitrophenyl)sulfonyl-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]amino]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(-c2cc(CN([C@H]3CCN(C(=O)OC(C)(C)C)C3)S(=O)(=O)c3ccccc3[N+](=O)[O-])ccn2)cc(C)c1C |
| InChI | InChI=1S/C30H36N4O6S/c1-20-15-24(16-21(2)22(20)3)26-17-23(11-13-31-26)18-33(25-12-14-32(19-25)29(35)40-30(4,5)6)41(38,39)28-10-8-7-9-27(28)34(36)37/h7-11,13,15-17,25H,12,14,18-19H2,1-6H3/t25-/m0/s1 |
| InChIKey | WQXJACGFZKCZKE-VWLOTQADSA-N |
| XLogP | 5.78 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|