C32H38F3N3O3 — CID 21352602
tert-butyl 4-[4-(trifluoromethoxy)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]anilino]piperidine-1-carboxylate (PubChem CID 21352602) has the molecular formula C32H38F3N3O3 and a molecular weight of 569.67 g/mol. Its IUPAC name is tert-butyl 4-[4-(trifluoromethoxy)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]anilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(trifluoromethoxy)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21352602 |
| Molecular Formula | C32H38F3N3O3 |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | tert-butyl 4-[4-(trifluoromethoxy)-N-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]anilino]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2cc(CN(c3ccc(OC(F)(F)F)cc3)C3CCN(C(=O)OC(C)(C)C)CC3)ccn2)cc(C)c1C |
| InChI | InChI=1S/C32H38F3N3O3/c1-21-17-25(18-22(2)23(21)3)29-19-24(11-14-36-29)20-38(26-7-9-28(10-8-26)40-32(33,34)35)27-12-15-37(16-13-27)30(39)41-31(4,5)6/h7-11,14,17-19,27H,12-13,15-16,20H2,1-6H3 |
| InChIKey | PXOAHFBGQGJJRQ-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|