C29H34FN3O3 — CID 22557910
tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methoxyanilino]piperidine-1-carboxylate (PubChem CID 22557910) has the molecular formula C29H34FN3O3 and a molecular weight of 491.61 g/mol. Its IUPAC name is tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methoxyanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methoxyanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22557910 |
| Molecular Formula | C29H34FN3O3 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | tert-butyl 4-[N-[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-4-methoxyanilino]piperidine-1-carboxylate |
| SMILES | COc1ccc(N(Cc2ccnc(-c3cccc(F)c3)c2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C29H34FN3O3/c1-29(2,3)36-28(34)32-16-13-25(14-17-32)33(24-8-10-26(35-4)11-9-24)20-21-12-15-31-27(18-21)22-6-5-7-23(30)19-22/h5-12,15,18-19,25H,13-14,16-17,20H2,1-4H3 |
| InChIKey | SBYORPNQCDAKEG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|