C36H34F2N4 — CID 21352365
N,1-bis[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine (PubChem CID 21352365) has the molecular formula C36H34F2N4 and a molecular weight of 560.69 g/mol. Its IUPAC name is N,1-bis[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine.
| Compound Name | N,1-bis[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 21352365 |
| Molecular Formula | C36H34F2N4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | N,1-bis[[2-(3-fluorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3cccc(F)c3)c2)C2CCN(Cc3ccnc(-c4cccc(F)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C36H34F2N4/c1-26-8-10-33(11-9-26)42(25-28-13-17-40-36(21-28)30-5-3-7-32(38)23-30)34-14-18-41(19-15-34)24-27-12-16-39-35(20-27)29-4-2-6-31(37)22-29/h2-13,16-17,20-23,34H,14-15,18-19,24-25H2,1H3 |
| InChIKey | KTSAYCNUIIBCQH-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|