C36H36N4 — CID 21352374
N-(4-methylphenyl)-N,1-bis[(2-phenyl-4-pyridinyl)methyl]piperidin-4-amine (PubChem CID 21352374) has the molecular formula C36H36N4 and a molecular weight of 524.71 g/mol. Its IUPAC name is N-(4-methylphenyl)-N,1-bis[(2-phenyl-4-pyridinyl)methyl]piperidin-4-amine.
| Compound Name | N-(4-methylphenyl)-N,1-bis[(2-phenyl-4-pyridinyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352374 |
| Molecular Formula | C36H36N4 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | N-(4-methylphenyl)-N,1-bis[(2-phenyl-4-pyridinyl)methyl]piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3ccccc3)c2)C2CCN(Cc3ccnc(-c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C36H36N4/c1-28-12-14-33(15-13-28)40(27-30-17-21-38-36(25-30)32-10-6-3-7-11-32)34-18-22-39(23-19-34)26-29-16-20-37-35(24-29)31-8-4-2-5-9-31/h2-17,20-21,24-25,34H,18-19,22-23,26-27H2,1H3 |
| InChIKey | QROIRNLEVULPMF-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|