C36H34Cl2N4 — CID 21352369
N,1-bis[[2-(4-chlorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine (PubChem CID 21352369) has the molecular formula C36H34Cl2N4 and a molecular weight of 593.60 g/mol. Its IUPAC name is N,1-bis[[2-(4-chlorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine.
| Compound Name | N,1-bis[[2-(4-chlorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 21352369 |
| Molecular Formula | C36H34Cl2N4 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | N,1-bis[[2-(4-chlorophenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3ccc(Cl)cc3)c2)C2CCN(Cc3ccnc(-c4ccc(Cl)cc4)c3)CC2)cc1 |
| InChI | InChI=1S/C36H34Cl2N4/c1-26-2-12-33(13-3-26)42(25-28-15-19-40-36(23-28)30-6-10-32(38)11-7-30)34-16-20-41(21-17-34)24-27-14-18-39-35(22-27)29-4-8-31(37)9-5-29/h2-15,18-19,22-23,34H,16-17,20-21,24-25H2,1H3 |
| InChIKey | IJBKNCXFLAPKJX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|