C40H44N4 — CID 21352363
N,1-bis[[2-(3,4-dimethylphenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine (PubChem CID 21352363) has the molecular formula C40H44N4 and a molecular weight of 580.82 g/mol. Its IUPAC name is N,1-bis[[2-(3,4-dimethylphenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine.
| Compound Name | N,1-bis[[2-(3,4-dimethylphenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 21352363 |
| Molecular Formula | C40H44N4 |
| Molecular Weight | 580.82 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | N,1-bis[[2-(3,4-dimethylphenyl)-4-pyridinyl]methyl]-N-(4-methylphenyl)piperidin-4-amine |
| SMILES | Cc1ccc(N(Cc2ccnc(-c3ccc(C)c(C)c3)c2)C2CCN(Cc3ccnc(-c4ccc(C)c(C)c4)c3)CC2)cc1 |
| InChI | InChI=1S/C40H44N4/c1-28-6-12-37(13-7-28)44(27-34-15-19-42-40(25-34)36-11-9-30(3)32(5)23-36)38-16-20-43(21-17-38)26-33-14-18-41-39(24-33)35-10-8-29(2)31(4)22-35/h6-15,18-19,22-25,38H,16-17,20-21,26-27H2,1-5H3 |
| InChIKey | YIRVADLDVLRAQL-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.82 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|