C43H50N4 — CID 21352412
N-(3,5-dimethylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352412) has the molecular formula C43H50N4 and a molecular weight of 622.90 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(3,5-dimethylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352412 |
| Molecular Formula | C43H50N4 |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-[[2-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]-1-[[2-(3,4,5-trimethylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(C)cc(N(Cc2cccnc2-c2cc(C)c(C)c(C)c2)C2CCN(Cc3ccnc(-c4cc(C)c(C)c(C)c4)c3)CC2)c1 |
| InChI | InChI=1S/C43H50N4/c1-28-18-29(2)20-41(19-28)47(27-37-10-9-14-45-43(37)39-23-32(5)35(8)33(6)24-39)40-12-16-46(17-13-40)26-36-11-15-44-42(25-36)38-21-30(3)34(7)31(4)22-38/h9-11,14-15,18-25,40H,12-13,16-17,26-27H2,1-8H3 |
| InChIKey | WWOSNAXQOMZVMK-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |