C35H45N3O5 — CID 142218027
tert-butyl 4-[N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-4-ethoxyanilino]piperidine-1-carboxylate (PubChem CID 142218027) has the molecular formula C35H45N3O5 and a molecular weight of 587.76 g/mol. Its IUPAC name is tert-butyl 4-[N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-4-ethoxyanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-4-ethoxyanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142218027 |
| Molecular Formula | C35H45N3O5 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | tert-butyl 4-[N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-4-ethoxyanilino]piperidine-1-carboxylate |
| SMILES | CCOc1ccc(N(Cc2ccnc(-c3cc(OC)c(OC)c(C4CC4)c3)c2)C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C35H45N3O5/c1-7-42-29-12-10-27(11-13-29)38(28-15-18-37(19-16-28)34(39)43-35(2,3)4)23-24-14-17-36-31(20-24)26-21-30(25-8-9-25)33(41-6)32(22-26)40-5/h10-14,17,20-22,25,28H,7-9,15-16,18-19,23H2,1-6H3 |
| InChIKey | ZUILSYZUYKPKHX-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|