C29H32F3N3O3 — CID 142217715
N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine (PubChem CID 142217715) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine.
| Compound Name | N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142217715 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N-[[2-(3-cyclopropyl-4,5-dimethoxyphenyl)-4-pyridinyl]methyl]-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
| SMILES | COc1cc(-c2cc(CN(c3ccc(OC(F)(F)F)cc3)C3CCNCC3)ccn2)cc(C2CC2)c1OC |
| InChI | InChI=1S/C29H32F3N3O3/c1-36-27-17-21(16-25(20-3-4-20)28(27)37-2)26-15-19(9-14-34-26)18-35(23-10-12-33-13-11-23)22-5-7-24(8-6-22)38-29(30,31)32/h5-9,14-17,20,23,33H,3-4,10-13,18H2,1-2H3 |
| InChIKey | YTOHDCXIPBCIOD-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|