C25H29N3O — CID 142217884
N-(4-methoxyphenyl)-N-[[2-(3-methylphenyl)-4-pyridinyl]methyl]piperidin-4-amine (PubChem CID 142217884) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-[[2-(3-methylphenyl)-4-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-N-[[2-(3-methylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142217884 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(4-methoxyphenyl)-N-[[2-(3-methylphenyl)-4-pyridinyl]methyl]piperidin-4-amine |
| SMILES | COc1ccc(N(Cc2ccnc(-c3cccc(C)c3)c2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C25H29N3O/c1-19-4-3-5-21(16-19)25-17-20(10-15-27-25)18-28(23-11-13-26-14-12-23)22-6-8-24(29-2)9-7-22/h3-10,15-17,23,26H,11-14,18H2,1-2H3 |
| InChIKey | BXYFIFYBMIWEBQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|