C27H32F3N3O4 — CID 142818355
N-[4-(trifluoromethoxy)phenyl]-N-[[6-(3,4,5-trimethoxyphenyl)-1,2-dihydropyridin-4-yl]methyl]piperidin-4-amine (PubChem CID 142818355) has the molecular formula C27H32F3N3O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-N-[[6-(3,4,5-trimethoxyphenyl)-1,2-dihydropyridin-4-yl]methyl]piperidin-4-amine.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-N-[[6-(3,4,5-trimethoxyphenyl)-1,2-dihydropyridin-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 142818355 |
| Molecular Formula | C27H32F3N3O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-N-[[6-(3,4,5-trimethoxyphenyl)-1,2-dihydropyridin-4-yl]methyl]piperidin-4-amine |
| SMILES | COc1cc(C2=CC(CN(c3ccc(OC(F)(F)F)cc3)C3CCNCC3)=CCN2)cc(OC)c1OC |
| InChI | InChI=1S/C27H32F3N3O4/c1-34-24-15-19(16-25(35-2)26(24)36-3)23-14-18(8-13-32-23)17-33(21-9-11-31-12-10-21)20-4-6-22(7-5-20)37-27(28,29)30/h4-8,14-16,21,31-32H,9-13,17H2,1-3H3 |
| InChIKey | BNECXLHXMQLOBK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|