C25H34ClN4O3S- — CID 53351236
2-[(1-benzylpiperidin-4-yl)amino]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide chloride (PubChem CID 53351236) has the molecular formula C25H34ClN4O3S- and a molecular weight of 506.09 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide chloride.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide chloride |
|---|---|
| PubChem CID | 53351236 |
| Molecular Formula | C25H34ClN4O3S- |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide chloride |
| SMILES | O=C(CNC1CCN(Cc2ccccc2)CC1)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1.[Cl-] |
| InChI | InChI=1S/C25H34N4O3S.ClH/c30-25(19-26-22-13-17-28(18-14-22)20-21-7-3-1-4-8-21)27-23-9-11-24(12-10-23)33(31,32)29-15-5-2-6-16-29;/h1,3-4,7-12,22,26H,2,5-6,13-20H2,(H,27,30);1H/p-1 |
| InChIKey | JYARCMNFSVDMFQ-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |