C36H41N5O2 — CID 73388766
N-(1-benzylpiperidin-4-yl)-N'-[2-(4-phenylpiperidin-1-yl)quinolin-6-yl]butanediamide (PubChem CID 73388766) has the molecular formula C36H41N5O2 and a molecular weight of 575.76 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N'-[2-(4-phenylpiperidin-1-yl)quinolin-6-yl]butanediamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N'-[2-(4-phenylpiperidin-1-yl)quinolin-6-yl]butanediamide |
|---|---|
| PubChem CID | 73388766 |
| Molecular Formula | C36H41N5O2 |
| Molecular Weight | 575.76 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N'-[2-(4-phenylpiperidin-1-yl)quinolin-6-yl]butanediamide |
| SMILES | O=C(CCC(=O)NC1CCN(Cc2ccccc2)CC1)Nc1ccc2nc(N3CCC(c4ccccc4)CC3)ccc2c1 |
| InChI | InChI=1S/C36H41N5O2/c42-35(37-31-19-21-40(22-20-31)26-27-7-3-1-4-8-27)15-16-36(43)38-32-12-13-33-30(25-32)11-14-34(39-33)41-23-17-29(18-24-41)28-9-5-2-6-10-28/h1-14,25,29,31H,15-24,26H2,(H,37,42)(H,38,43) |
| InChIKey | FSSPKUYUIZQCFO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.76 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |