C24H33N5O3 — CID 22427010
N'-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]-N-(oxolan-2-ylmethyl)butanediamide (PubChem CID 22427010) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N'-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]-N-(oxolan-2-ylmethyl)butanediamide.
| Compound Name | N'-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]-N-(oxolan-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 22427010 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N'-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]-N-(oxolan-2-ylmethyl)butanediamide |
| SMILES | Cc1cc(N2CCN(C)CC2)nc2ccc(NC(=O)CCC(=O)NCC3CCCO3)cc12 |
| InChI | InChI=1S/C24H33N5O3/c1-17-14-22(29-11-9-28(2)10-12-29)27-21-6-5-18(15-20(17)21)26-24(31)8-7-23(30)25-16-19-4-3-13-32-19/h5-6,14-15,19H,3-4,7-13,16H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | MSFSHGYAIKJVBD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |