C30H33N5O2S — CID 5097479
N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 5097479) has the molecular formula C30H33N5O2S and a molecular weight of 527.69 g/mol. Its IUPAC name is N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5097479 |
| Molecular Formula | C30H33N5O2S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]-2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc3ccccc3c2)o1)Nc1ccc(N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C30H33N5O2S/c36-28(21-38-30-33-32-29(37-30)24-11-10-22-6-4-5-7-23(22)20-24)31-25-12-14-27(15-13-25)35-18-16-34(17-19-35)26-8-2-1-3-9-26/h4-7,10-15,20,26H,1-3,8-9,16-19,21H2,(H,31,36) |
| InChIKey | SSCGURGXAMAQHB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|