C25H29ClN4O2S — CID 4603295
2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4603295) has the molecular formula C25H29ClN4O2S and a molecular weight of 485.05 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4603295 |
| Molecular Formula | C25H29ClN4O2S |
| Molecular Weight | 485.05 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 2-[(5-chloro-1,3-benzoxazol-2-yl)sulfanyl]-N-[4-(4-cyclohexylpiperazin-1-yl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2o1)Nc1ccc(N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C25H29ClN4O2S/c26-18-6-11-23-22(16-18)28-25(32-23)33-17-24(31)27-19-7-9-21(10-8-19)30-14-12-29(13-15-30)20-4-2-1-3-5-20/h6-11,16,20H,1-5,12-15,17H2,(H,27,31) |
| InChIKey | ZLJGBCWUEKYGBC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|