C21H23N3O5S2 — CID 23799347
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 23799347) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 23799347 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ccc(N4CCOCC4)cc3)nc2c1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-2-31(26,27)17-7-8-19-18(13-17)23-21(29-19)30-14-20(25)22-15-3-5-16(6-4-15)24-9-11-28-12-10-24/h3-8,13H,2,9-12,14H2,1H3,(H,22,25) |
| InChIKey | KEBBIMRTYKRGMC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|