C19H26N2O4S2 — CID 23761832
N-cyclooctyl-2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]acetamide (PubChem CID 23761832) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-cyclooctyl-2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-cyclooctyl-2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 23761832 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-cyclooctyl-2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)NC3CCCCCCC3)nc2c1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-2-27(23,24)15-10-11-17-16(12-15)21-19(25-17)26-13-18(22)20-14-8-6-4-3-5-7-9-14/h10-12,14H,2-9,13H2,1H3,(H,20,22) |
| InChIKey | PKUCFGRTYOCAQU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |