C17H15IN2O4S2 — CID 23903330
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 23903330) has the molecular formula C17H15IN2O4S2 and a molecular weight of 502.36 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 23903330 |
| Molecular Formula | C17H15IN2O4S2 |
| Molecular Weight | 502.36 g/mol |
| Exact Mass | 501.95 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ccc(I)cc3)nc2c1 |
| InChI | InChI=1S/C17H15IN2O4S2/c1-2-26(22,23)13-7-8-15-14(9-13)20-17(24-15)25-10-16(21)19-12-5-3-11(18)4-6-12/h3-9H,2,10H2,1H3,(H,19,21) |
| InChIKey | WBHCQZAFEGAILQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|