C18H17IN2O4S2 — CID 23932573
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide (PubChem CID 23932573) has the molecular formula C18H17IN2O4S2 and a molecular weight of 516.38 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide.
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 23932573 |
| Molecular Formula | C18H17IN2O4S2 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(4-iodo-2-methylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ccc(I)cc3C)nc2c1 |
| InChI | InChI=1S/C18H17IN2O4S2/c1-3-27(23,24)13-5-7-16-15(9-13)21-18(25-16)26-10-17(22)20-14-6-4-12(19)8-11(14)2/h4-9H,3,10H2,1-2H3,(H,20,22) |
| InChIKey | JMBNQKZHRXSNCB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|