C18H17N3O7S2 — CID 23738367
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 23738367) has the molecular formula C18H17N3O7S2 and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23738367 |
| Molecular Formula | C18H17N3O7S2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ccc([N+](=O)[O-])cc3OC)nc2c1 |
| InChI | InChI=1S/C18H17N3O7S2/c1-3-30(25,26)12-5-7-15-14(9-12)20-18(28-15)29-10-17(22)19-13-6-4-11(21(23)24)8-16(13)27-2/h4-9H,3,10H2,1-2H3,(H,19,22) |
| InChIKey | LFYAUALUKHVYJP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|