C19H15N5O7S3 — CID 4694006
2-[[5-[(2-methoxyphenyl)sulfamoyl]-1,3-benzoxazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide (PubChem CID 4694006) has the molecular formula C19H15N5O7S3 and a molecular weight of 521.56 g/mol. Its IUPAC name is 2-[[5-[(2-methoxyphenyl)sulfamoyl]-1,3-benzoxazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-[(2-methoxyphenyl)sulfamoyl]-1,3-benzoxazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4694006 |
| Molecular Formula | C19H15N5O7S3 |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | 2-[[5-[(2-methoxyphenyl)sulfamoyl]-1,3-benzoxazol-2-yl]sulfanyl]-N-(5-nitro-1,3-thiazol-2-yl)acetamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ncc([N+](=O)[O-])s3)nc2c1 |
| InChI | InChI=1S/C19H15N5O7S3/c1-30-14-5-3-2-4-12(14)23-34(28,29)11-6-7-15-13(8-11)21-19(31-15)32-10-16(25)22-18-20-9-17(33-18)24(26)27/h2-9,23H,10H2,1H3,(H,20,22,25) |
| InChIKey | BPGHAXWUTLOIFB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|