C17H15N3O6S2 — CID 23855615
2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 23855615) has the molecular formula C17H15N3O6S2 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 23855615 |
| Molecular Formula | C17H15N3O6S2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 2-[(5-ethylsulfonyl-1,3-benzoxazol-2-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc2oc(SCC(=O)Nc3ccccc3[N+](=O)[O-])nc2c1 |
| InChI | InChI=1S/C17H15N3O6S2/c1-2-28(24,25)11-7-8-15-13(9-11)19-17(26-15)27-10-16(21)18-12-5-3-4-6-14(12)20(22)23/h3-9H,2,10H2,1H3,(H,18,21) |
| InChIKey | NCJCQIWOYKZMNP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|