C16H32N10O — CID 58865494
3-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]propan-1-ol (PubChem CID 58865494) has the molecular formula C16H32N10O and a molecular weight of 380.50 g/mol. Its IUPAC name is 3-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 58865494 |
| Molecular Formula | C16H32N10O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.28 |
| IUPAC Name | 3-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]propan-1-ol |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(NCCCO)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C16H32N10O/c17-10-4-11(18)7-25(6-10)15-22-14(21-2-1-3-27)23-16(24-15)26-8-12(19)5-13(20)9-26/h10-13,27H,1-9,17-20H2,(H,21,22,23,24)/t10-,11+,12-,13+ |
| InChIKey | SFZZKRZADFFFSZ-MPZDIEGVSA-N |
| XLogP | -2.60 |
| TPSA | 181.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|