C27H38N10 — CID 21103835
1-[4-(3,5-diaminopiperidin-1-yl)-6-(1,2-diphenylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21103835) has the molecular formula C27H38N10 and a molecular weight of 502.67 g/mol. Its IUPAC name is 1-[4-(3,5-diaminopiperidin-1-yl)-6-(1,2-diphenylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(1,2-diphenylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21103835 |
| Molecular Formula | C27H38N10 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 1-[4-(3,5-diaminopiperidin-1-yl)-6-(1,2-diphenylethylamino)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NC1CC(N)CN(c2nc(NC(Cc3ccccc3)c3ccccc3)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C27H38N10/c28-20-12-21(29)15-36(14-20)26-33-25(34-27(35-26)37-16-22(30)13-23(31)17-37)32-24(19-9-5-2-6-10-19)11-18-7-3-1-4-8-18/h1-10,20-24H,11-17,28-31H2,(H,32,33,34,35) |
| InChIKey | LDNHKVUDMUJDSS-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |