C9H13N9S — CID 80922351
[4-pyrrolidin-1-yl-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80922351) has the molecular formula C9H13N9S and a molecular weight of 279.33 g/mol. Its IUPAC name is [4-pyrrolidin-1-yl-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-pyrrolidin-1-yl-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80922351 |
| Molecular Formula | C9H13N9S |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [4-pyrrolidin-1-yl-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | NNc1nc(Sc2ncn[nH]2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C9H13N9S/c10-16-6-13-7(18-3-1-2-4-18)15-9(14-6)19-8-11-5-12-17-8/h5H,1-4,10H2,(H,11,12,17)(H,13,14,15,16) |
| InChIKey | SFCQHUKSUZXZDG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 121.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|