C9H10N10S — CID 80884418
N-ethyl-4-(1,2,4-triazol-1-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 80884418) has the molecular formula C9H10N10S and a molecular weight of 290.32 g/mol. Its IUPAC name is N-ethyl-4-(1,2,4-triazol-1-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-(1,2,4-triazol-1-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80884418 |
| Molecular Formula | C9H10N10S |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-ethyl-4-(1,2,4-triazol-1-yl)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Sc2ncn[nH]2)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C9H10N10S/c1-2-11-6-15-7(19-5-10-3-14-19)17-9(16-6)20-8-12-4-13-18-8/h3-5H,2H2,1H3,(H,12,13,18)(H,11,15,16,17) |
| InChIKey | DUHZCWVRXINMPW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |