C12H20N8O — CID 104767007
4-N-ethyl-2-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 104767007) has the molecular formula C12H20N8O and a molecular weight of 292.35 g/mol. Its IUPAC name is 4-N-ethyl-2-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 104767007 |
| Molecular Formula | C12H20N8O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-N-ethyl-2-N-(2-propan-2-yloxyethyl)-6-(1,2,4-triazol-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCCOC(C)C)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C12H20N8O/c1-4-14-10-17-11(15-5-6-21-9(2)3)19-12(18-10)20-8-13-7-16-20/h7-9H,4-6H2,1-3H3,(H2,14,15,17,18,19) |
| InChIKey | LBVWFQHHVWZQCO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|