C11H16N8OS — CID 80925112
[4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80925112) has the molecular formula C11H16N8OS and a molecular weight of 308.37 g/mol. Its IUPAC name is [4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80925112 |
| Molecular Formula | C11H16N8OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | [4-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-6-piperidin-1-yl-1,3,5-triazin-2-yl]hydrazine |
| SMILES | Cc1nnc(Sc2nc(NN)nc(N3CCCCC3)n2)o1 |
| InChI | InChI=1S/C11H16N8OS/c1-7-17-18-11(20-7)21-10-14-8(16-12)13-9(15-10)19-5-3-2-4-6-19/h2-6,12H2,1H3,(H,13,14,15,16) |
| InChIKey | PRRWOLORBRSTGA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 118.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|