C13H23N7 — CID 80911324
N-(1-cyclopropylpropan-2-yl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80911324) has the molecular formula C13H23N7 and a molecular weight of 277.38 g/mol. Its IUPAC name is N-(1-cyclopropylpropan-2-yl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(1-cyclopropylpropan-2-yl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80911324 |
| Molecular Formula | C13H23N7 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-(1-cyclopropylpropan-2-yl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CC(CC1CC1)Nc1nc(NN)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H23N7/c1-9(8-10-4-5-10)15-11-16-12(19-14)18-13(17-11)20-6-2-3-7-20/h9-10H,2-8,14H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | LFMNWKYHAMDVAC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|