C9H13F2N5O2 — CID 82008989
4-(2,2-difluoroethoxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 82008989) has the molecular formula C9H13F2N5O2 and a molecular weight of 261.23 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 82008989 |
| Molecular Formula | C9H13F2N5O2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(OCC(F)F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H13F2N5O2/c10-6(11)5-18-9-14-7(12)13-8(15-9)16-1-3-17-4-2-16/h6H,1-5H2,(H2,12,13,14,15) |
| InChIKey | GNWAWFKCFUNCIO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |