C14H23N5O2 — CID 80845160
4-(2-methylcyclohexyl)oxy-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 80845160) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(2-methylcyclohexyl)oxy-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-methylcyclohexyl)oxy-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80845160 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-(2-methylcyclohexyl)oxy-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CC1CCCCC1Oc1nc(N)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C14H23N5O2/c1-10-4-2-3-5-11(10)21-14-17-12(15)16-13(18-14)19-6-8-20-9-7-19/h10-11H,2-9H2,1H3,(H2,15,16,17,18) |
| InChIKey | YQTQMDOEZWCYFH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |