C10H17N5OS — CID 80885930
4-morpholin-4-yl-6-propan-2-ylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 80885930) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-propan-2-ylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-morpholin-4-yl-6-propan-2-ylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80885930 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-morpholin-4-yl-6-propan-2-ylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CC(C)Sc1nc(N)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H17N5OS/c1-7(2)17-10-13-8(11)12-9(14-10)15-3-5-16-6-4-15/h7H,3-6H2,1-2H3,(H2,11,12,13,14) |
| InChIKey | OGBCLVGOTQLYNJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |