C10H16N4OS — CID 10562037
4-(3-propan-2-ylsulfanyl-1,2,4-triazin-5-yl)morpholine (PubChem CID 10562037) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-(3-propan-2-ylsulfanyl-1,2,4-triazin-5-yl)morpholine.
| Compound Name | 4-(3-propan-2-ylsulfanyl-1,2,4-triazin-5-yl)morpholine |
|---|---|
| PubChem CID | 10562037 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-(3-propan-2-ylsulfanyl-1,2,4-triazin-5-yl)morpholine |
| SMILES | CC(C)Sc1nncc(N2CCOCC2)n1 |
| InChI | InChI=1S/C10H16N4OS/c1-8(2)16-10-12-9(7-11-13-10)14-3-5-15-6-4-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | GLNRRWBVCVTYJN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |