C13H14FN5OS — CID 80887155
4-(3-fluorophenyl)sulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 80887155) has the molecular formula C13H14FN5OS and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-(3-fluorophenyl)sulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-(3-fluorophenyl)sulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80887155 |
| Molecular Formula | C13H14FN5OS |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-(3-fluorophenyl)sulfanyl-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Sc2cccc(F)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H14FN5OS/c14-9-2-1-3-10(8-9)21-13-17-11(15)16-12(18-13)19-4-6-20-7-5-19/h1-3,8H,4-7H2,(H2,15,16,17,18) |
| InChIKey | ZRPIRWXBWDIBAY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |