C16H20N4O3S — CID 122526454
3-(4,6-dimethoxy-2-morpholin-4-ylpyrimidin-5-yl)sulfanylaniline (PubChem CID 122526454) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-(4,6-dimethoxy-2-morpholin-4-ylpyrimidin-5-yl)sulfanylaniline.
| Compound Name | 3-(4,6-dimethoxy-2-morpholin-4-ylpyrimidin-5-yl)sulfanylaniline |
|---|---|
| PubChem CID | 122526454 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-(4,6-dimethoxy-2-morpholin-4-ylpyrimidin-5-yl)sulfanylaniline |
| SMILES | COc1nc(N2CCOCC2)nc(OC)c1Sc1cccc(N)c1 |
| InChI | InChI=1S/C16H20N4O3S/c1-21-14-13(24-12-5-3-4-11(17)10-12)15(22-2)19-16(18-14)20-6-8-23-9-7-20/h3-5,10H,6-9,17H2,1-2H3 |
| InChIKey | KFZXJSWSZRUIIU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|