C13H23N5O — CID 80842750
4-(4,4-dimethylazepan-1-yl)-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 80842750) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 4-(4,4-dimethylazepan-1-yl)-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(4,4-dimethylazepan-1-yl)-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80842750 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 4-(4,4-dimethylazepan-1-yl)-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(N2CCCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C13H23N5O/c1-4-19-12-16-10(14)15-11(17-12)18-8-5-6-13(2,3)7-9-18/h4-9H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | UHAXYIYXHUZPJN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |