C14H25N5O — CID 80837736
4-ethoxy-6-(4-propan-2-ylazepan-1-yl)-1,3,5-triazin-2-amine (PubChem CID 80837736) has the molecular formula C14H25N5O and a molecular weight of 279.39 g/mol. Its IUPAC name is 4-ethoxy-6-(4-propan-2-ylazepan-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-ethoxy-6-(4-propan-2-ylazepan-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80837736 |
| Molecular Formula | C14H25N5O |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | 4-ethoxy-6-(4-propan-2-ylazepan-1-yl)-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(N)nc(N2CCCC(C(C)C)CC2)n1 |
| InChI | InChI=1S/C14H25N5O/c1-4-20-14-17-12(15)16-13(18-14)19-8-5-6-11(7-9-19)10(2)3/h10-11H,4-9H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | YSABTLOPLHCWLF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |